C34H37Cl2N5O — CID 142123936
4,6-dichloro-N-[[3-[[[1,5-dimethyl-4-[(Z)-prop-1-enyl]pyrrol-3-yl]methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-3H-azepine-5-carboxamide (PubChem CID 142123936) has the molecular formula C34H37Cl2N5O and a molecular weight of 602.61 g/mol. Its IUPAC name is 4,6-dichloro-N-[[3-[[[1,5-dimethyl-4-[(Z)-prop-1-enyl]pyrrol-3-yl]methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-3H-azepine-5-carboxamide.
| Compound Name | 4,6-dichloro-N-[[3-[[[1,5-dimethyl-4-[(Z)-prop-1-enyl]pyrrol-3-yl]methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-3H-azepine-5-carboxamide |
|---|---|
| PubChem CID | 142123936 |
| Molecular Formula | C34H37Cl2N5O |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 4,6-dichloro-N-[[3-[[[1,5-dimethyl-4-[(Z)-prop-1-enyl]pyrrol-3-yl]methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-3H-azepine-5-carboxamide |
| SMILES | C/C=C\c1c(CN(Cc2cccc(CNC(=O)C3=C(Cl)CC=NC=C3Cl)c2)C2CCCc3cccnc32)cn(C)c1C |
| InChI | InChI=1S/C34H37Cl2N5O/c1-4-8-28-23(2)40(3)21-27(28)22-41(31-13-6-11-26-12-7-15-38-33(26)31)20-25-10-5-9-24(17-25)18-39-34(42)32-29(35)14-16-37-19-30(32)36/h4-5,7-10,12,15-17,19,21,31H,6,11,13-14,18,20,22H2,1-3H3,(H,39,42)/b8-4- |
| InChIKey | UOTFOXXCEXNGIK-YWEYNIOJSA-N |
| XLogP | 7.51 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |