C28H27Cl2N5O2 — CID 68898250
3,5-dichloro-N-[[4-[[(5-methyl-1,3-oxazol-2-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 68898250) has the molecular formula C28H27Cl2N5O2 and a molecular weight of 536.46 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-[[(5-methyl-1,3-oxazol-2-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 3,5-dichloro-N-[[4-[[(5-methyl-1,3-oxazol-2-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 68898250 |
| Molecular Formula | C28H27Cl2N5O2 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | 3,5-dichloro-N-[[4-[[(5-methyl-1,3-oxazol-2-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | Cc1cnc(CN(Cc2ccc(CNC(=O)c3c(Cl)cncc3Cl)cc2)C2CCCc3cccnc32)o1 |
| InChI | InChI=1S/C28H27Cl2N5O2/c1-18-12-33-25(37-18)17-35(24-6-2-4-21-5-3-11-32-27(21)24)16-20-9-7-19(8-10-20)13-34-28(36)26-22(29)14-31-15-23(26)30/h3,5,7-12,14-15,24H,2,4,6,13,16-17H2,1H3,(H,34,36) |
| InChIKey | XZMVPVHHTFJUBF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |