C29H31ClN6O — CID 151581798
3-chloro-N-[[4-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 151581798) has the molecular formula C29H31ClN6O and a molecular weight of 515.06 g/mol. Its IUPAC name is 3-chloro-N-[[4-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[[4-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 151581798 |
| Molecular Formula | C29H31ClN6O |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 3-chloro-N-[[4-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | Cc1nc(CN(Cc2ccc(CNC(=O)c3ccncc3Cl)cc2)C2CCCc3cccnc32)c(C)[nH]1 |
| InChI | InChI=1S/C29H31ClN6O/c1-19-26(35-20(2)34-19)18-36(27-7-3-5-23-6-4-13-32-28(23)27)17-22-10-8-21(9-11-22)15-33-29(37)24-12-14-31-16-25(24)30/h4,6,8-14,16,27H,3,5,7,15,17-18H2,1-2H3,(H,33,37)(H,34,35) |
| InChIKey | QGQPTFKAXJCSAX-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |