C30H34N6O — CID 22601324
N-[[4-[[2-(1H-imidazol-2-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-2,4-dimethylpyridine-3-carboxamide (PubChem CID 22601324) has the molecular formula C30H34N6O and a molecular weight of 494.64 g/mol. Its IUPAC name is N-[[4-[[2-(1H-imidazol-2-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | N-[[4-[[2-(1H-imidazol-2-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 22601324 |
| Molecular Formula | C30H34N6O |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | N-[[4-[[2-(1H-imidazol-2-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-2,4-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccnc(C)c1C(=O)NCc1ccc(CN(CCc2ncc[nH]2)C2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C30H34N6O/c1-21-12-15-31-22(2)28(21)30(37)35-19-23-8-10-24(11-9-23)20-36(18-13-27-32-16-17-33-27)26-7-3-5-25-6-4-14-34-29(25)26/h4,6,8-12,14-17,26H,3,5,7,13,18-20H2,1-2H3,(H,32,33)(H,35,37) |
| InChIKey | VHDYYTAQNSYVAA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |