C28H28Cl2N6O — CID 10208892
3,5-dichloro-N-[[4-[[(5-methyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 10208892) has the molecular formula C28H28Cl2N6O and a molecular weight of 535.48 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-[[(5-methyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 3,5-dichloro-N-[[4-[[(5-methyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10208892 |
| Molecular Formula | C28H28Cl2N6O |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 3,5-dichloro-N-[[4-[[(5-methyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | Cc1[nH]cnc1CN(Cc1ccc(CNC(=O)c2c(Cl)cncc2Cl)cc1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C28H28Cl2N6O/c1-18-24(35-17-34-18)16-36(25-6-2-4-21-5-3-11-32-27(21)25)15-20-9-7-19(8-10-20)12-33-28(37)26-22(29)13-31-14-23(26)30/h3,5,7-11,13-14,17,25H,2,4,6,12,15-16H2,1H3,(H,33,37)(H,34,35) |
| InChIKey | WDXKUGKTTWTQQQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |