C29H30Cl2N6O — CID 10280786
3,5-dichloro-N-[[4-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 10280786) has the molecular formula C29H30Cl2N6O and a molecular weight of 549.51 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 3,5-dichloro-N-[[4-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 10280786 |
| Molecular Formula | C29H30Cl2N6O |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 3,5-dichloro-N-[[4-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | Cc1nc(CN(Cc2ccc(CNC(=O)c3c(Cl)cncc3Cl)cc2)C2CCCc3cccnc32)c(C)[nH]1 |
| InChI | InChI=1S/C29H30Cl2N6O/c1-18-25(36-19(2)35-18)17-37(26-7-3-5-22-6-4-12-33-28(22)26)16-21-10-8-20(9-11-21)13-34-29(38)27-23(30)14-32-15-24(27)31/h4,6,8-12,14-15,26H,3,5,7,13,16-17H2,1-2H3,(H,34,38)(H,35,36) |
| InChIKey | LFXCHLWXJOLTQU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |