C33H41ClN6O — CID 142123957
3-chloro-N-[[3-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(6,7,8,9-tetrahydro-4H-1-benzazepin-9-yl)amino]methyl]phenyl]methyl]-5-methylpyridine-4-carboxamide;ethane (PubChem CID 142123957) has the molecular formula C33H41ClN6O and a molecular weight of 573.19 g/mol. Its IUPAC name is 3-chloro-N-[[3-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(6,7,8,9-tetrahydro-4H-1-benzazepin-9-yl)amino]methyl]phenyl]methyl]-5-methylpyridine-4-carboxamide;ethane.
| Compound Name | 3-chloro-N-[[3-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(6,7,8,9-tetrahydro-4H-1-benzazepin-9-yl)amino]methyl]phenyl]methyl]-5-methylpyridine-4-carboxamide;ethane |
|---|---|
| PubChem CID | 142123957 |
| Molecular Formula | C33H41ClN6O |
| Molecular Weight | 573.19 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | 3-chloro-N-[[3-[[(2,5-dimethyl-1H-imidazol-4-yl)methyl-(6,7,8,9-tetrahydro-4H-1-benzazepin-9-yl)amino]methyl]phenyl]methyl]-5-methylpyridine-4-carboxamide;ethane |
| SMILES | CC.Cc1nc(CN(Cc2cccc(CNC(=O)c3c(C)cncc3Cl)c2)C2CCCC3=CCC=CN=C32)c(C)[nH]1 |
| InChI | InChI=1S/C31H35ClN6O.C2H6/c1-20-15-33-17-26(32)29(20)31(39)35-16-23-8-6-9-24(14-23)18-38(19-27-21(2)36-22(3)37-27)28-12-7-11-25-10-4-5-13-34-30(25)28;1-2/h5-6,8-10,13-15,17,28H,4,7,11-12,16,18-19H2,1-3H3,(H,35,39)(H,36,37);1-2H3 |
| InChIKey | JGQOJNSLTOSMAY-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.19 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |