C34H32Cl2N6O2 — CID 91422597
3,5-dichloro-N-[[3-[[[1H-imidazol-2-yl-(3-methoxyphenyl)methyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 91422597) has the molecular formula C34H32Cl2N6O2 and a molecular weight of 627.58 g/mol. Its IUPAC name is 3,5-dichloro-N-[[3-[[[1H-imidazol-2-yl-(3-methoxyphenyl)methyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 3,5-dichloro-N-[[3-[[[1H-imidazol-2-yl-(3-methoxyphenyl)methyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 91422597 |
| Molecular Formula | C34H32Cl2N6O2 |
| Molecular Weight | 627.58 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 3,5-dichloro-N-[[3-[[[1H-imidazol-2-yl-(3-methoxyphenyl)methyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | COc1cccc(C(c2ncc[nH]2)N(Cc2cccc(CNC(=O)c3c(Cl)cncc3Cl)c2)C2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C34H32Cl2N6O2/c1-44-26-11-3-9-25(17-26)32(33-39-14-15-40-33)42(29-12-4-8-24-10-5-13-38-31(24)29)21-23-7-2-6-22(16-23)18-41-34(43)30-27(35)19-37-20-28(30)36/h2-3,5-7,9-11,13-17,19-20,29,32H,4,8,12,18,21H2,1H3,(H,39,40)(H,41,43) |
| InChIKey | TXEFWWGVFCZUPU-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.58 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |