C31H37Cl2N7O — CID 142123923
3,5-dichloro-N-[[3-[[2-[2-[methanimidoyl(methyl)amino]prop-2-enylamino]ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-N-methylpyridine-4-carboxamide (PubChem CID 142123923) has the molecular formula C31H37Cl2N7O and a molecular weight of 594.59 g/mol. Its IUPAC name is 3,5-dichloro-N-[[3-[[2-[2-[methanimidoyl(methyl)amino]prop-2-enylamino]ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-N-methylpyridine-4-carboxamide.
| Compound Name | 3,5-dichloro-N-[[3-[[2-[2-[methanimidoyl(methyl)amino]prop-2-enylamino]ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 142123923 |
| Molecular Formula | C31H37Cl2N7O |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | 3,5-dichloro-N-[[3-[[2-[2-[methanimidoyl(methyl)amino]prop-2-enylamino]ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]-N-methylpyridine-4-carboxamide |
| SMILES | [H]/N=C/N(C)C(=C)CNCCN(Cc1cccc(CN(C)C(=O)c2c(Cl)cncc2Cl)c1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C31H37Cl2N7O/c1-22(39(3)21-34)16-35-13-14-40(28-11-5-9-25-10-6-12-37-30(25)28)20-24-8-4-7-23(15-24)19-38(2)31(41)29-26(32)17-36-18-27(29)33/h4,6-8,10,12,15,17-18,21,28,34-35H,1,5,9,11,13-14,16,19-20H2,2-3H3/b34-21+ |
| InChIKey | DYSBRKFNYWJDTM-KEIPNQJHSA-N |
| XLogP | 5.58 |
| TPSA | 88.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|