C30H36N6OS — CID 142123955
4-[[4-[[(4,7-dimethyl-5H-1,3-diazepine-6-carbonyl)amino]methyl]phenyl]methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]but-1-en-2-yl methanimidothioate (PubChem CID 142123955) has the molecular formula C30H36N6OS and a molecular weight of 528.73 g/mol. Its IUPAC name is 4-[[4-[[(4,7-dimethyl-5H-1,3-diazepine-6-carbonyl)amino]methyl]phenyl]methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]but-1-en-2-yl methanimidothioate.
| Compound Name | 4-[[4-[[(4,7-dimethyl-5H-1,3-diazepine-6-carbonyl)amino]methyl]phenyl]methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]but-1-en-2-yl methanimidothioate |
|---|---|
| PubChem CID | 142123955 |
| Molecular Formula | C30H36N6OS |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | 4-[[4-[[(4,7-dimethyl-5H-1,3-diazepine-6-carbonyl)amino]methyl]phenyl]methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]but-1-en-2-yl methanimidothioate |
| SMILES | [H]/N=C/SC(=C)CCN(Cc1ccc(CNC(=O)C2=C(C)N=CN=C(C)C2)cc1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C30H36N6OS/c1-21-16-27(23(3)35-20-34-21)30(37)33-17-24-9-11-25(12-10-24)18-36(15-13-22(2)38-19-31)28-8-4-6-26-7-5-14-32-29(26)28/h5,7,9-12,14,19-20,28,31H,2,4,6,8,13,15-18H2,1,3H3,(H,33,37)/b31-19+ |
| InChIKey | SGOVBJOALNYGQW-ZCTHSVRISA-N |
| XLogP | 5.99 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|