C30H33N5OS — CID 22601310
2,4-dimethyl-N-[[4-[[5,6,7,8-tetrahydroquinolin-8-yl-[2-(1,3-thiazol-2-yl)ethyl]amino]methyl]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 22601310) has the molecular formula C30H33N5OS and a molecular weight of 511.70 g/mol. Its IUPAC name is 2,4-dimethyl-N-[[4-[[5,6,7,8-tetrahydroquinolin-8-yl-[2-(1,3-thiazol-2-yl)ethyl]amino]methyl]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | 2,4-dimethyl-N-[[4-[[5,6,7,8-tetrahydroquinolin-8-yl-[2-(1,3-thiazol-2-yl)ethyl]amino]methyl]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22601310 |
| Molecular Formula | C30H33N5OS |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 2,4-dimethyl-N-[[4-[[5,6,7,8-tetrahydroquinolin-8-yl-[2-(1,3-thiazol-2-yl)ethyl]amino]methyl]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | Cc1ccnc(C)c1C(=O)NCc1ccc(CN(CCc2nccs2)C2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C30H33N5OS/c1-21-12-15-31-22(2)28(21)30(36)34-19-23-8-10-24(11-9-23)20-35(17-13-27-32-16-18-37-27)26-7-3-5-25-6-4-14-33-29(25)26/h4,6,8-12,14-16,18,26H,3,5,7,13,17,19-20H2,1-2H3,(H,34,36) |
| InChIKey | AJDXMPUCUZLUIS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |