C29H30ClN5O2 — CID 174403232
2-chloro-N-[[3-[[2-(4-methyl-1,3-oxazol-2-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 174403232) has the molecular formula C29H30ClN5O2 and a molecular weight of 516.05 g/mol. Its IUPAC name is 2-chloro-N-[[3-[[2-(4-methyl-1,3-oxazol-2-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[[3-[[2-(4-methyl-1,3-oxazol-2-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 174403232 |
| Molecular Formula | C29H30ClN5O2 |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 2-chloro-N-[[3-[[2-(4-methyl-1,3-oxazol-2-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | Cc1coc(CCN(Cc2cccc(CNC(=O)c3ccnc(Cl)c3)c2)C2CCCc3cccnc32)n1 |
| InChI | InChI=1S/C29H30ClN5O2/c1-20-19-37-27(34-20)11-14-35(25-9-3-7-23-8-4-12-32-28(23)25)18-22-6-2-5-21(15-22)17-33-29(36)24-10-13-31-26(30)16-24/h2,4-6,8,10,12-13,15-16,19,25H,3,7,9,11,14,17-18H2,1H3,(H,33,36) |
| InChIKey | RHGBZTNUVRXMTC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|