C29H30ClN5O2 — CID 150877709
3-chloro-N-[[4-[[2-(2-methyl-1,3-oxazol-5-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide (PubChem CID 150877709) has the molecular formula C29H30ClN5O2 and a molecular weight of 516.05 g/mol. Its IUPAC name is 3-chloro-N-[[4-[[2-(2-methyl-1,3-oxazol-5-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[[4-[[2-(2-methyl-1,3-oxazol-5-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 150877709 |
| Molecular Formula | C29H30ClN5O2 |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 3-chloro-N-[[4-[[2-(2-methyl-1,3-oxazol-5-yl)ethyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]pyridine-4-carboxamide |
| SMILES | Cc1ncc(CCN(Cc2ccc(CNC(=O)c3ccncc3Cl)cc2)C2CCCc3cccnc32)o1 |
| InChI | InChI=1S/C29H30ClN5O2/c1-20-33-17-24(37-20)12-15-35(27-6-2-4-23-5-3-13-32-28(23)27)19-22-9-7-21(8-10-22)16-34-29(36)25-11-14-31-18-26(25)30/h3,5,7-11,13-14,17-18,27H,2,4,6,12,15-16,19H2,1H3,(H,34,36) |
| InChIKey | KVISLYZHFUHLDE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |