C28H30N6O3 — CID 68898673
(4,6-dimethylpyrimidin-5-yl) N-[[4-[[1,3-oxazol-5-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]carbamate (PubChem CID 68898673) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-5-yl) N-[[4-[[1,3-oxazol-5-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]carbamate.
| Compound Name | (4,6-dimethylpyrimidin-5-yl) N-[[4-[[1,3-oxazol-5-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 68898673 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | (4,6-dimethylpyrimidin-5-yl) N-[[4-[[1,3-oxazol-5-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]phenyl]methyl]carbamate |
| SMILES | Cc1ncnc(C)c1OC(=O)NCc1ccc(CN(Cc2cnco2)C2CCCc3cccnc32)cc1 |
| InChI | InChI=1S/C28H30N6O3/c1-19-27(20(2)33-17-32-19)37-28(35)31-13-21-8-10-22(11-9-21)15-34(16-24-14-29-18-36-24)25-7-3-5-23-6-4-12-30-26(23)25/h4,6,8-12,14,17-18,25H,3,5,7,13,15-16H2,1-2H3,(H,31,35) |
| InChIKey | DPUFLUTYNZVMMA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |