C22H24ClN7 — CID 142126740
2-amino-N'-[2-(2-chlorophenyl)-5-methyl-6-piperazin-1-ylpyrimidin-4-yl]benzenecarboximidamide (PubChem CID 142126740) has the molecular formula C22H24ClN7 and a molecular weight of 421.94 g/mol. Its IUPAC name is 2-amino-N'-[2-(2-chlorophenyl)-5-methyl-6-piperazin-1-ylpyrimidin-4-yl]benzenecarboximidamide.
| Compound Name | 2-amino-N'-[2-(2-chlorophenyl)-5-methyl-6-piperazin-1-ylpyrimidin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142126740 |
| Molecular Formula | C22H24ClN7 |
| Molecular Weight | 421.94 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-amino-N'-[2-(2-chlorophenyl)-5-methyl-6-piperazin-1-ylpyrimidin-4-yl]benzenecarboximidamide |
| SMILES | Cc1c(/N=C(\N)c2ccccc2N)nc(-c2ccccc2Cl)nc1N1CCNCC1 |
| InChI | InChI=1S/C22H24ClN7/c1-14-20(27-19(25)16-7-3-5-9-18(16)24)28-21(15-6-2-4-8-17(15)23)29-22(14)30-12-10-26-11-13-30/h2-9,26H,10-13,24H2,1H3,(H2,25,27,28,29) |
| InChIKey | MDVMEQPGELHJGA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.94 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|