C16H14ClN7 — CID 142127901
2-amino-N'-[6-amino-3-(2-chlorophenyl)-1,2,4-triazin-5-yl]benzenecarboximidamide (PubChem CID 142127901) has the molecular formula C16H14ClN7 and a molecular weight of 339.79 g/mol. Its IUPAC name is 2-amino-N'-[6-amino-3-(2-chlorophenyl)-1,2,4-triazin-5-yl]benzenecarboximidamide.
| Compound Name | 2-amino-N'-[6-amino-3-(2-chlorophenyl)-1,2,4-triazin-5-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142127901 |
| Molecular Formula | C16H14ClN7 |
| Molecular Weight | 339.79 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-amino-N'-[6-amino-3-(2-chlorophenyl)-1,2,4-triazin-5-yl]benzenecarboximidamide |
| SMILES | N/C(=N\c1nc(-c2ccccc2Cl)nnc1N)c1ccccc1N |
| InChI | InChI=1S/C16H14ClN7/c17-11-7-3-1-5-9(11)15-22-16(14(20)23-24-15)21-13(19)10-6-2-4-8-12(10)18/h1-8H,18H2,(H2,20,23)(H2,19,21,22,24) |
| InChIKey | PWHLRFLOWJDKFQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 129.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.79 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|