C24H19ClN4 — CID 142125546
2-amino-N'-[2-(2-chlorophenyl)-6-phenyl-4-pyridinyl]benzenecarboximidamide (PubChem CID 142125546) has the molecular formula C24H19ClN4 and a molecular weight of 398.90 g/mol. Its IUPAC name is 2-amino-N'-[2-(2-chlorophenyl)-6-phenyl-4-pyridinyl]benzenecarboximidamide.
| Compound Name | 2-amino-N'-[2-(2-chlorophenyl)-6-phenyl-4-pyridinyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142125546 |
| Molecular Formula | C24H19ClN4 |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-amino-N'-[2-(2-chlorophenyl)-6-phenyl-4-pyridinyl]benzenecarboximidamide |
| SMILES | N/C(=N\c1cc(-c2ccccc2)nc(-c2ccccc2Cl)c1)c1ccccc1N |
| InChI | InChI=1S/C24H19ClN4/c25-20-12-6-4-10-18(20)23-15-17(14-22(29-23)16-8-2-1-3-9-16)28-24(27)19-11-5-7-13-21(19)26/h1-15H,26H2,(H2,27,28,29) |
| InChIKey | HDQJZHWJGVFQPT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|