C26H24BClN2 — CID 142128339
4-[2-[amino(propyl)boranyl]phenyl]-2-(2-chlorophenyl)-6-phenylpyridine (PubChem CID 142128339) has the molecular formula C26H24BClN2 and a molecular weight of 410.76 g/mol. Its IUPAC name is 4-[2-[amino(propyl)boranyl]phenyl]-2-(2-chlorophenyl)-6-phenylpyridine.
| Compound Name | 4-[2-[amino(propyl)boranyl]phenyl]-2-(2-chlorophenyl)-6-phenylpyridine |
|---|---|
| PubChem CID | 142128339 |
| Molecular Formula | C26H24BClN2 |
| Molecular Weight | 410.76 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[2-[amino(propyl)boranyl]phenyl]-2-(2-chlorophenyl)-6-phenylpyridine |
| SMILES | CCCB(N)c1ccccc1-c1cc(-c2ccccc2)nc(-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C26H24BClN2/c1-2-16-27(29)23-14-8-6-12-21(23)20-17-25(19-10-4-3-5-11-19)30-26(18-20)22-13-7-9-15-24(22)28/h3-15,17-18H,2,16,29H2,1H3 |
| InChIKey | ZSIZJHCPAZFHMU-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.76 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|