C20H19F3N6 — CID 162578271
2-amino-N'-[6-(2-aminoethyl)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]benzenecarboximidamide (PubChem CID 162578271) has the molecular formula C20H19F3N6 and a molecular weight of 400.41 g/mol. Its IUPAC name is 2-amino-N'-[6-(2-aminoethyl)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]benzenecarboximidamide.
| Compound Name | 2-amino-N'-[6-(2-aminoethyl)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 162578271 |
| Molecular Formula | C20H19F3N6 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-amino-N'-[6-(2-aminoethyl)-2-[2-(trifluoromethyl)phenyl]pyrimidin-4-yl]benzenecarboximidamide |
| SMILES | NCCc1cc(/N=C(\N)c2ccccc2N)nc(-c2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C20H19F3N6/c21-20(22,23)15-7-3-1-5-13(15)19-27-12(9-10-24)11-17(29-19)28-18(26)14-6-2-4-8-16(14)25/h1-8,11H,9-10,24-25H2,(H2,26,27,28,29) |
| InChIKey | HVPRXEDQYXHTCI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|