C20H15F4N5O — CID 142125600
2-amino-5-fluoro-N'-[2-[2-(trifluoromethyl)phenyl]-6,7-dihydrofuro[3,2-d]pyrimidin-4-yl]benzenecarboximidamide (PubChem CID 142125600) has the molecular formula C20H15F4N5O and a molecular weight of 417.37 g/mol. Its IUPAC name is 2-amino-5-fluoro-N'-[2-[2-(trifluoromethyl)phenyl]-6,7-dihydrofuro[3,2-d]pyrimidin-4-yl]benzenecarboximidamide.
| Compound Name | 2-amino-5-fluoro-N'-[2-[2-(trifluoromethyl)phenyl]-6,7-dihydrofuro[3,2-d]pyrimidin-4-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142125600 |
| Molecular Formula | C20H15F4N5O |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-amino-5-fluoro-N'-[2-[2-(trifluoromethyl)phenyl]-6,7-dihydrofuro[3,2-d]pyrimidin-4-yl]benzenecarboximidamide |
| SMILES | N/C(=N\c1nc(-c2ccccc2C(F)(F)F)nc2c1OCC2)c1cc(F)ccc1N |
| InChI | InChI=1S/C20H15F4N5O/c21-10-5-6-14(25)12(9-10)17(26)28-19-16-15(7-8-30-16)27-18(29-19)11-3-1-2-4-13(11)20(22,23)24/h1-6,9H,7-8,25H2,(H2,26,27,28,29) |
| InChIKey | BVWAGGGCMXEVRL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|