C22H16F3N7 — CID 161136601
2-amino-N'-[4-pyridin-4-yl-6-[2-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]benzenecarboximidamide (PubChem CID 161136601) has the molecular formula C22H16F3N7 and a molecular weight of 435.41 g/mol. Its IUPAC name is 2-amino-N'-[4-pyridin-4-yl-6-[2-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]benzenecarboximidamide.
| Compound Name | 2-amino-N'-[4-pyridin-4-yl-6-[2-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 161136601 |
| Molecular Formula | C22H16F3N7 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-amino-N'-[4-pyridin-4-yl-6-[2-(trifluoromethyl)phenyl]-1,3,5-triazin-2-yl]benzenecarboximidamide |
| SMILES | NC(=Nc1nc(-c2ccncc2)nc(-c2ccccc2C(F)(F)F)n1)c1ccccc1N |
| InChI | InChI=1S/C22H16F3N7/c23-22(24,25)16-7-3-1-5-14(16)20-30-19(13-9-11-28-12-10-13)31-21(32-20)29-18(27)15-6-2-4-8-17(15)26/h1-12H,26H2,(H2,27,29,30,31,32) |
| InChIKey | UMWODTZMHRWMTE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|