C19H16F3N5O — CID 146968394
2-amino-N'-[4-aminooxy-6-[2-(trifluoromethyl)phenyl]-2-pyridinyl]benzenecarboximidamide (PubChem CID 146968394) has the molecular formula C19H16F3N5O and a molecular weight of 387.37 g/mol. Its IUPAC name is 2-amino-N'-[4-aminooxy-6-[2-(trifluoromethyl)phenyl]-2-pyridinyl]benzenecarboximidamide.
| Compound Name | 2-amino-N'-[4-aminooxy-6-[2-(trifluoromethyl)phenyl]-2-pyridinyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 146968394 |
| Molecular Formula | C19H16F3N5O |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-amino-N'-[4-aminooxy-6-[2-(trifluoromethyl)phenyl]-2-pyridinyl]benzenecarboximidamide |
| SMILES | NOc1cc(N=C(N)c2ccccc2N)nc(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3N5O/c20-19(21,22)14-7-3-1-5-12(14)16-9-11(28-25)10-17(26-16)27-18(24)13-6-2-4-8-15(13)23/h1-10H,23,25H2,(H2,24,26,27) |
| InChIKey | ALYLQDGZNGZZIQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|