C27H42F3N5 — CID 142127844
2-[amino(methyl)amino]ethanamine;(Z)-1-cyclohexyl-3-(2-methylphenyl)prop-1-en-1-amine;[2-(trifluoromethyl)phenyl]methanamine (PubChem CID 142127844) has the molecular formula C27H42F3N5 and a molecular weight of 493.66 g/mol. Its IUPAC name is 2-[amino(methyl)amino]ethanamine;(Z)-1-cyclohexyl-3-(2-methylphenyl)prop-1-en-1-amine;[2-(trifluoromethyl)phenyl]methanamine.
| Compound Name | 2-[amino(methyl)amino]ethanamine;(Z)-1-cyclohexyl-3-(2-methylphenyl)prop-1-en-1-amine;[2-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 142127844 |
| Molecular Formula | C27H42F3N5 |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.34 |
| IUPAC Name | 2-[amino(methyl)amino]ethanamine;(Z)-1-cyclohexyl-3-(2-methylphenyl)prop-1-en-1-amine;[2-(trifluoromethyl)phenyl]methanamine |
| SMILES | CN(N)CCN.Cc1ccccc1C/C=C(\N)C1CCCCC1.NCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H23N.C8H8F3N.C3H11N3/c1-13-7-5-6-8-14(13)11-12-16(17)15-9-3-2-4-10-15;9-8(10,11)7-4-2-1-3-6(7)5-12;1-6(5)3-2-4/h5-8,12,15H,2-4,9-11,17H2,1H3;1-4H,5,12H2;2-5H2,1H3/b16-12-;; |
| InChIKey | DOGDSZMTXXCNHX-DAANKRAASA-N |
| XLogP | 4.88 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|