About ethanethial;(2-methylphenyl)methanamine
ethanethial;(2-methylphenyl)methanamine (PubChem CID 143288844) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is ethanethial;(2-methylphenyl)methanamine.
Molecular Properties
| Compound Name | ethanethial;(2-methylphenyl)methanamine |
| PubChem CID | 143288844 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | ethanethial;(2-methylphenyl)methanamine |
| SMILES | CC=S.Cc1ccccc1CN |
| InChI | InChI=1S/C8H11N.C2H4S/c1-7-4-2-3-5-8(7)6-9;1-2-3/h2-5H,6,9H2,1H3;2H,1H3 |
| InChIKey | DZSIKRUYQSLAJX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethanethial;(2-methylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethial;(2-methylphenyl)methanamine?
The IUPAC name of ethanethial;(2-methylphenyl)methanamine (CID 143288844) is ethanethial;(2-methylphenyl)methanamine.
What is the SMILES notation for ethanethial;(2-methylphenyl)methanamine?
The canonical SMILES for ethanethial;(2-methylphenyl)methanamine is CC=S.Cc1ccccc1CN.
What is the InChIKey of ethanethial;(2-methylphenyl)methanamine?
The InChIKey is DZSIKRUYQSLAJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C2H4S/c1-7-4-2-3-5-8(7)6-9;1-2-3/h2-5H,6,9H2,1H3;2H,1H3.
What are the key properties of ethanethial;(2-methylphenyl)methanamine?
ethanethial;(2-methylphenyl)methanamine has a molecular weight of 181.30 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethial;(2-methylphenyl)methanamine is sourced from PubChem (CID 143288844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).