C24H29ClN4 — CID 142130165
N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-4-(5-imino-4H-pyridin-2-yl)-N-methylbutan-1-amine (PubChem CID 142130165) has the molecular formula C24H29ClN4 and a molecular weight of 408.98 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-4-(5-imino-4H-pyridin-2-yl)-N-methylbutan-1-amine.
| Compound Name | N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-4-(5-imino-4H-pyridin-2-yl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 142130165 |
| Molecular Formula | C24H29ClN4 |
| Molecular Weight | 408.98 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-4-(5-imino-4H-pyridin-2-yl)-N-methylbutan-1-amine |
| SMILES | [H]/N=C1\C=NC(CCCCN(C)CCC(c2ccc(Cl)cc2)c2ccccn2)=CC1 |
| InChI | InChI=1S/C24H29ClN4/c1-29(16-5-3-6-22-13-12-21(26)18-28-22)17-14-23(24-7-2-4-15-27-24)19-8-10-20(25)11-9-19/h2,4,7-11,13,15,18,23,26H,3,5-6,12,14,16-17H2,1H3/b26-21- |
| InChIKey | XUPLTBOFMLCBSU-QLYXXIJNSA-N |
| XLogP | 5.74 |
| TPSA | 52.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.98 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|