C26H38N4O — CID 142130829
N-[4-[(8aR)-3-cyano-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-yl]phenyl]-N-methyl-5-piperidin-1-ylpentanamide (PubChem CID 142130829) has the molecular formula C26H38N4O and a molecular weight of 422.62 g/mol. Its IUPAC name is N-[4-[(8aR)-3-cyano-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-yl]phenyl]-N-methyl-5-piperidin-1-ylpentanamide.
| Compound Name | N-[4-[(8aR)-3-cyano-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-yl]phenyl]-N-methyl-5-piperidin-1-ylpentanamide |
|---|---|
| PubChem CID | 142130829 |
| Molecular Formula | C26H38N4O |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | N-[4-[(8aR)-3-cyano-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-yl]phenyl]-N-methyl-5-piperidin-1-ylpentanamide |
| SMILES | CN(C(=O)CCCCN1CCCCC1)c1ccc(C2(C#N)CC[C@H]3CCCCN32)cc1 |
| InChI | InChI=1S/C26H38N4O/c1-28(25(31)10-4-7-19-29-17-5-2-6-18-29)23-13-11-22(12-14-23)26(21-27)16-15-24-9-3-8-20-30(24)26/h11-14,24H,2-10,15-20H2,1H3/t24-,26?/m1/s1 |
| InChIKey | JOIUZHOQFIZNEX-RMVMEJTISA-N |
| XLogP | 4.67 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|