C14H24N2O — CID 142135032
N-tert-butyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline-3-carboxamide (PubChem CID 142135032) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-tert-butyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline-3-carboxamide.
| Compound Name | N-tert-butyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 142135032 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-tert-butyl-2,3,4,4a,5,6,7,8-octahydroisoquinoline-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC2CCCCC2=CN1 |
| InChI | InChI=1S/C14H24N2O/c1-14(2,3)16-13(17)12-8-10-6-4-5-7-11(10)9-15-12/h9-10,12,15H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | SOGDWQPGBHNKLS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |