C12H23NO2 — CID 142135233
4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperidin-4-ol;methanol (PubChem CID 142135233) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperidin-4-ol;methanol.
| Compound Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperidin-4-ol;methanol |
|---|---|
| PubChem CID | 142135233 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 4-[(2E,4Z)-hexa-2,4-dien-3-yl]piperidin-4-ol;methanol |
| SMILES | C/C=C\C(=C/C)C1(O)CCNCC1.CO |
| InChI | InChI=1S/C11H19NO.CH4O/c1-3-5-10(4-2)11(13)6-8-12-9-7-11;1-2/h3-5,12-13H,6-9H2,1-2H3;2H,1H3/b5-3-,10-4+; |
| InChIKey | CLOXOSIMVVWXBO-BOWQZNNWSA-N |
| XLogP | 1.23 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|