About 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol
1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol (PubChem CID 67420181) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol.
Molecular Properties
| Compound Name | 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol |
| PubChem CID | 67420181 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol |
| SMILES | CCNCCC1(O)C=CC=CC1O |
| InChI | InChI=1S/C10H17NO2/c1-2-11-8-7-10(13)6-4-3-5-9(10)12/h3-6,9,11-13H,2,7-8H2,1H3 |
| InChIKey | AHTJDWBIHOEEMK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol?
The IUPAC name of 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol (CID 67420181) is 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol is CCNCCC1(O)C=CC=CC1O.
What is the InChIKey of 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol?
The InChIKey is AHTJDWBIHOEEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-2-11-8-7-10(13)6-4-3-5-9(10)12/h3-6,9,11-13H,2,7-8H2,1H3.
What are the key properties of 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol?
1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol has a molecular weight of 183.25 g/mol, XLogP of 0.20, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 67420181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).