C10H17NO2 — CID 67420181
1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol (PubChem CID 67420181) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol.
| Compound Name | 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 67420181 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1-[2-(ethylamino)ethyl]cyclohexa-3,5-diene-1,2-diol |
| SMILES | CCNCCC1(O)C=CC=CC1O |
| InChI | InChI=1S/C10H17NO2/c1-2-11-8-7-10(13)6-4-3-5-9(10)12/h3-6,9,11-13H,2,7-8H2,1H3 |
| InChIKey | AHTJDWBIHOEEMK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|