C12H17NO2 — CID 163187875
(4S,4aR,5E,7aR)-5-[(E)-but-2-enylidene]-2,3,4,7a-tetrahydro-1H-cyclopenta[b]pyridine-4,4a-diol (PubChem CID 163187875) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (4S,4aR,5E,7aR)-5-[(E)-but-2-enylidene]-2,3,4,7a-tetrahydro-1H-cyclopenta[b]pyridine-4,4a-diol.
| Compound Name | (4S,4aR,5E,7aR)-5-[(E)-but-2-enylidene]-2,3,4,7a-tetrahydro-1H-cyclopenta[b]pyridine-4,4a-diol |
|---|---|
| PubChem CID | 163187875 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (4S,4aR,5E,7aR)-5-[(E)-but-2-enylidene]-2,3,4,7a-tetrahydro-1H-cyclopenta[b]pyridine-4,4a-diol |
| SMILES | C/C=C/C=C1\C=C[C@H]2NCC[C@H](O)[C@@]12O |
| InChI | InChI=1S/C12H17NO2/c1-2-3-4-9-5-6-10-12(9,15)11(14)7-8-13-10/h2-6,10-11,13-15H,7-8H2,1H3/b3-2+,9-4+/t10-,11+,12-/m1/s1 |
| InChIKey | ARZACIBPCRSMMK-BYXYKIIKSA-N |
| XLogP | 0.51 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |