C8H9NS3 — CID 142135635
2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5,7-dithione (PubChem CID 142135635) has the molecular formula C8H9NS3 and a molecular weight of 215.37 g/mol. Its IUPAC name is 2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5,7-dithione.
| Compound Name | 2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5,7-dithione |
|---|---|
| PubChem CID | 142135635 |
| Molecular Formula | C8H9NS3 |
| Molecular Weight | 215.37 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5,7-dithione |
| SMILES | S=C1C=C2SCCCC2C(=S)N1 |
| InChI | InChI=1S/C8H9NS3/c10-7-4-6-5(8(11)9-7)2-1-3-12-6/h4-5H,1-3H2,(H,9,10,11) |
| InChIKey | KVASTWVFQBKFDF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|