C32H43NO7S — CID 142136825
(4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl) (2S)-2-(2-tert-butylsulfanyl-2-oxoethyl)-6,6-dimethyloxane-2-carboxylate (PubChem CID 142136825) has the molecular formula C32H43NO7S and a molecular weight of 585.76 g/mol. Its IUPAC name is (4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl) (2S)-2-(2-tert-butylsulfanyl-2-oxoethyl)-6,6-dimethyloxane-2-carboxylate.
| Compound Name | (4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl) (2S)-2-(2-tert-butylsulfanyl-2-oxoethyl)-6,6-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 142136825 |
| Molecular Formula | C32H43NO7S |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | (4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl) (2S)-2-(2-tert-butylsulfanyl-2-oxoethyl)-6,6-dimethyloxane-2-carboxylate |
| SMILES | COC1=CC23CCCN2CCc2cc4c(cc2C3C1OC(=O)[C@@]1(CC(=O)SC(C)(C)C)CCCC(C)(C)O1)OCO4 |
| InChI | InChI=1S/C32H43NO7S/c1-29(2,3)41-25(34)18-32(12-7-10-30(4,5)40-32)28(35)39-27-24(36-6)17-31-11-8-13-33(31)14-9-20-15-22-23(38-19-37-22)16-21(20)26(27)31/h15-17,26-27H,7-14,18-19H2,1-6H3/t26?,27?,31?,32-/m0/s1 |
| InChIKey | UOILTFIXMZLCJW-HSZPLVJSSA-N |
| XLogP | 5.51 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|