C32H43NO6S — CID 59070862
[(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-2-(2-tert-butylsulfanyl-2-oxoethyl)-6,6-dimethyloxane-2-carboxylate (PubChem CID 59070862) has the molecular formula C32H43NO6S and a molecular weight of 569.76 g/mol. Its IUPAC name is [(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-2-(2-tert-butylsulfanyl-2-oxoethyl)-6,6-dimethyloxane-2-carboxylate.
| Compound Name | [(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-2-(2-tert-butylsulfanyl-2-oxoethyl)-6,6-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59070862 |
| Molecular Formula | C32H43NO6S |
| Molecular Weight | 569.76 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | [(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-2-(2-tert-butylsulfanyl-2-oxoethyl)-6,6-dimethyloxane-2-carboxylate |
| SMILES | CC1=C[C@]23CCCN2CCc2cc4c(cc2[C@@H]3C1OC(=O)[C@]1(CC(=O)SC(C)(C)C)CCCC(C)(C)O1)OCO4 |
| InChI | InChI=1S/C32H43NO6S/c1-20-17-31-11-8-13-33(31)14-9-21-15-23-24(37-19-36-23)16-22(21)26(31)27(20)38-28(35)32(12-7-10-30(5,6)39-32)18-25(34)40-29(2,3)4/h15-17,26-27H,7-14,18-19H2,1-6H3/t26-,27?,31+,32-/m1/s1 |
| InChIKey | DMVYMEHVRUIRJR-PJMRRPJDSA-N |
| XLogP | 5.93 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.76 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|