C30H36F3NO7 — CID 59070889
[(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-6,6-dimethyl-2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]oxane-2-carboxylate (PubChem CID 59070889) has the molecular formula C30H36F3NO7 and a molecular weight of 579.61 g/mol. Its IUPAC name is [(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-6,6-dimethyl-2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]oxane-2-carboxylate.
| Compound Name | [(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-6,6-dimethyl-2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 59070889 |
| Molecular Formula | C30H36F3NO7 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | [(2S,6S)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] (2R)-6,6-dimethyl-2-[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl]oxane-2-carboxylate |
| SMILES | CC1=C[C@]23CCCN2CCc2cc4c(cc2[C@@H]3C1OC(=O)[C@]1(CC(=O)OCC(F)(F)F)CCCC(C)(C)O1)OCO4 |
| InChI | InChI=1S/C30H36F3NO7/c1-18-14-28-8-5-10-34(28)11-6-19-12-21-22(39-17-38-21)13-20(19)24(28)25(18)40-26(36)29(9-4-7-27(2,3)41-29)15-23(35)37-16-30(31,32)33/h12-14,24-25H,4-11,15-17H2,1-3H3/t24-,25?,28+,29-/m1/s1 |
| InChIKey | JCZGZWPOYPISLF-DJWDSZJHSA-N |
| XLogP | 4.97 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|