C28H35NO7 — CID 158844087
2-[(2R)-6,6-dimethyl-2-[[(2S,6R)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl]oxycarbonyl]oxan-2-yl]acetic acid (PubChem CID 158844087) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is 2-[(2R)-6,6-dimethyl-2-[[(2S,6R)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl]oxycarbonyl]oxan-2-yl]acetic acid.
| Compound Name | 2-[(2R)-6,6-dimethyl-2-[[(2S,6R)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl]oxycarbonyl]oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 158844087 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | 2-[(2R)-6,6-dimethyl-2-[[(2S,6R)-4-methyl-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl]oxycarbonyl]oxan-2-yl]acetic acid |
| SMILES | CC1=C[C@@]23CCCN2CCc2cc4c(cc2[C@@H]3C1OC(=O)[C@]1(CC(=O)O)CCCC(C)(C)O1)OCO4 |
| InChI | InChI=1S/C28H35NO7/c1-17-14-27-8-5-10-29(27)11-6-18-12-20-21(34-16-33-20)13-19(18)23(27)24(17)35-25(32)28(15-22(30)31)9-4-7-26(2,3)36-28/h12-14,23-24H,4-11,15-16H2,1-3H3,(H,30,31)/t23-,24?,27-,28-/m1/s1 |
| InChIKey | UHDDGLNNGUQQOG-RKPACFMLSA-N |
| XLogP | 3.95 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|