About (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane
(3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane (PubChem CID 142137705) has the molecular formula C20H28Cl2N2O2
and a molecular weight of 399.36 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane.
Molecular Properties
| Compound Name | (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane |
| PubChem CID | 142137705 |
| Molecular Formula | C20H28Cl2N2O2 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane |
| SMILES | CC.O=C(c1cc(Cl)cc(Cl)c1)C1CCN(C(=O)C2CCNCC2)CC1 |
| InChI | InChI=1S/C18H22Cl2N2O2.C2H6/c19-15-9-14(10-16(20)11-15)17(23)12-3-7-22(8-4-12)18(24)13-1-5-21-6-2-13;1-2/h9-13,21H,1-8H2;1-2H3 |
| InChIKey | JTWRWRCFHXIMMJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane?
The IUPAC name of (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane (CID 142137705) is (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane.
What is the SMILES notation for (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane?
The canonical SMILES for (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane is CC.O=C(c1cc(Cl)cc(Cl)c1)C1CCN(C(=O)C2CCNCC2)CC1.
What is the InChIKey of (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane?
The InChIKey is JTWRWRCFHXIMMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22Cl2N2O2.C2H6/c19-15-9-14(10-16(20)11-15)17(23)12-3-7-22(8-4-12)18(24)13-1-5-21-6-2-13;1-2/h9-13,21H,1-8H2;1-2H3.
What are the key properties of (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane?
(3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane has a molecular weight of 399.36 g/mol, XLogP of 4.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichlorophenyl)-[1-(piperidine-4-carbonyl)piperidin-4-yl]methanone;ethane is sourced from PubChem (CID 142137705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).