C32H35N3O6 — CID 142137914
1-[2-(4-benzhydrylpiperazine-1-carbonyl)pyrrolidin-1-yl]-2-(4-hydroxy-3,5-dimethoxyphenyl)ethane-1,2-dione (PubChem CID 142137914) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is 1-[2-(4-benzhydrylpiperazine-1-carbonyl)pyrrolidin-1-yl]-2-(4-hydroxy-3,5-dimethoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-[2-(4-benzhydrylpiperazine-1-carbonyl)pyrrolidin-1-yl]-2-(4-hydroxy-3,5-dimethoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 142137914 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 1-[2-(4-benzhydrylpiperazine-1-carbonyl)pyrrolidin-1-yl]-2-(4-hydroxy-3,5-dimethoxyphenyl)ethane-1,2-dione |
| SMILES | COc1cc(C(=O)C(=O)N2CCCC2C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc(OC)c1O |
| InChI | InChI=1S/C32H35N3O6/c1-40-26-20-24(21-27(41-2)30(26)37)29(36)32(39)35-15-9-14-25(35)31(38)34-18-16-33(17-19-34)28(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-8,10-13,20-21,25,28,37H,9,14-19H2,1-2H3 |
| InChIKey | PNOGMXLAQURUSA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|