C14H21N — CID 142140525
butane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine (PubChem CID 142140525) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is butane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine.
| Compound Name | butane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine |
|---|---|
| PubChem CID | 142140525 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | butane;(3E,4Z)-4-ethylidene-3-prop-2-enylidenepyridine |
| SMILES | C=C/C=c1/cncc/c1=C/C.CCCC |
| InChI | InChI=1S/C10H11N.C4H10/c1-3-5-10-8-11-7-6-9(10)4-2;1-3-4-2/h3-8H,1H2,2H3;3-4H2,1-2H3/b9-4-,10-5-; |
| InChIKey | YQZANIXXULGFIO-DRWVTRDWSA-N |
| XLogP | 2.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |