C8H13N3 — CID 142140844
3-[(E)-but-1-enyl]-4,5-dimethyl-1,2,4-triazole (PubChem CID 142140844) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-[(E)-but-1-enyl]-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-[(E)-but-1-enyl]-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 142140844 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 3-[(E)-but-1-enyl]-4,5-dimethyl-1,2,4-triazole |
| SMILES | CC/C=C/c1nnc(C)n1C |
| InChI | InChI=1S/C8H13N3/c1-4-5-6-8-10-9-7(2)11(8)3/h5-6H,4H2,1-3H3/b6-5+ |
| InChIKey | KEZXSIPKLDPSDD-AATRIKPKSA-N |
| XLogP | 1.55 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |