C14H17N3O5 — CID 142140953
methyl formate;4-(4-nitrophenyl)-N-propan-2-yl-1,3-oxazol-2-amine (PubChem CID 142140953) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is methyl formate;4-(4-nitrophenyl)-N-propan-2-yl-1,3-oxazol-2-amine.
| Compound Name | methyl formate;4-(4-nitrophenyl)-N-propan-2-yl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 142140953 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | methyl formate;4-(4-nitrophenyl)-N-propan-2-yl-1,3-oxazol-2-amine |
| SMILES | CC(C)Nc1nc(-c2ccc([N+](=O)[O-])cc2)co1.COC=O |
| InChI | InChI=1S/C12H13N3O3.C2H4O2/c1-8(2)13-12-14-11(7-18-12)9-3-5-10(6-4-9)15(16)17;1-4-2-3/h3-8H,1-2H3,(H,13,14);2H,1H3 |
| InChIKey | RNOLYNNDOUGNBA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|