C11H8N2O4 — CID 20623543
2-methyl-5-(4-nitrophenyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 20623543) has the molecular formula C11H8N2O4 and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-methyl-5-(4-nitrophenyl)-1,3-oxazole-4-carbaldehyde.
| Compound Name | 2-methyl-5-(4-nitrophenyl)-1,3-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 20623543 |
| Molecular Formula | C11H8N2O4 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-methyl-5-(4-nitrophenyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | Cc1nc(C=O)c(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C11H8N2O4/c1-7-12-10(6-14)11(17-7)8-2-4-9(5-3-8)13(15)16/h2-6H,1H3 |
| InChIKey | WJEBKJZPLWVNQM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|