About 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole
1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole (PubChem CID 142141206) has the molecular formula C22H21N3
and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole |
| PubChem CID | 142141206 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole |
| SMILES | Cc1ccccc1C(c1ccccc1)c1ccccc1.c1nc[nH]n1 |
| InChI | InChI=1S/C20H18.C2H3N3/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18;1-3-2-5-4-1/h2-15,20H,1H3;1-2H,(H,3,4,5) |
| InChIKey | DMASXZSNGNKTQO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole?
The IUPAC name of 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole (CID 142141206) is 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole.
What is the SMILES notation for 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole?
The canonical SMILES for 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole is Cc1ccccc1C(c1ccccc1)c1ccccc1.c1nc[nH]n1.
What is the InChIKey of 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole?
The InChIKey is DMASXZSNGNKTQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18.C2H3N3/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18;1-3-2-5-4-1/h2-15,20H,1H3;1-2H,(H,3,4,5).
What are the key properties of 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole?
1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole has a molecular weight of 327.43 g/mol, XLogP of 4.98, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryl-2-methylbenzene;1H-1,2,4-triazole is sourced from PubChem (CID 142141206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).