C35H34 — CID 142141320
(2S)-1-(3,6-dimethyl-3-phenyl-6,7-dihydro-4H-naphthalen-1-yl)-2-methyl-3-phenyl-1,2-dihydronaphthalene (PubChem CID 142141320) has the molecular formula C35H34 and a molecular weight of 454.66 g/mol. Its IUPAC name is (2S)-1-(3,6-dimethyl-3-phenyl-6,7-dihydro-4H-naphthalen-1-yl)-2-methyl-3-phenyl-1,2-dihydronaphthalene.
| Compound Name | (2S)-1-(3,6-dimethyl-3-phenyl-6,7-dihydro-4H-naphthalen-1-yl)-2-methyl-3-phenyl-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 142141320 |
| Molecular Formula | C35H34 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (2S)-1-(3,6-dimethyl-3-phenyl-6,7-dihydro-4H-naphthalen-1-yl)-2-methyl-3-phenyl-1,2-dihydronaphthalene |
| SMILES | CC1C=C2CC(C)(c3ccccc3)C=C(C3c4ccccc4C=C(c4ccccc4)[C@H]3C)C2=CC1 |
| InChI | InChI=1S/C35H34/c1-24-18-19-30-28(20-24)22-35(3,29-15-8-5-9-16-29)23-33(30)34-25(2)32(26-12-6-4-7-13-26)21-27-14-10-11-17-31(27)34/h4-17,19-21,23-25,34H,18,22H2,1-3H3/t24?,25-,34?,35?/m1/s1 |
| InChIKey | CQCUGVMBHRSUKM-KNOLRQAXSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|