C8H12FO2P — CID 142143106
fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid (PubChem CID 142143106) has the molecular formula C8H12FO2P and a molecular weight of 190.15 g/mol. Its IUPAC name is fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid.
| Compound Name | fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid |
|---|---|
| PubChem CID | 142143106 |
| Molecular Formula | C8H12FO2P |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid |
| SMILES | C=C/C=C(\C=C/C)CP(=O)(O)F |
| InChI | InChI=1S/C8H12FO2P/c1-3-5-8(6-4-2)7-12(9,10)11/h3-6H,1,7H2,2H3,(H,10,11)/b6-4-,8-5+ |
| InChIKey | UXWPEAXKBZOXPJ-QXMOYCCXSA-N |
| XLogP | 2.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|