fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid

C8H12FO2P — CID 142143106

IUPACfluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid
SMILESC=C/C=C(\C=C/C)CP(=O)(O)F
InChIInChI=1S/C8H12FO2P/c1-3-5-8(6-4-2)7-12(9,10)11/h3-6H,1,7H2,2H3,(H,10,11)/b6-4-,8-5+
InChIKeyUXWPEAXKBZOXPJ-QXMOYCCXSA-N
MW190.15 g/mol
LogP2.83
Rot. Bonds4

About fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid

fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid (PubChem CID 142143106) has the molecular formula C8H12FO2P and a molecular weight of 190.15 g/mol. Its IUPAC name is fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid.

Molecular Properties

Compound Namefluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid
PubChem CID142143106
Molecular FormulaC8H12FO2P
Molecular Weight190.15 g/mol
Exact Mass190.06
IUPAC Namefluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid
SMILESC=C/C=C(\C=C/C)CP(=O)(O)F
InChIInChI=1S/C8H12FO2P/c1-3-5-8(6-4-2)7-12(9,10)11/h3-6H,1,7H2,2H3,(H,10,11)/b6-4-,8-5+
InChIKeyUXWPEAXKBZOXPJ-QXMOYCCXSA-N
XLogP2.83
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.15
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid?
The IUPAC name of fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid (CID 142143106) is fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid.
What is the SMILES notation for fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid?
The canonical SMILES for fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid is C=C/C=C(\C=C/C)CP(=O)(O)F.
What is the InChIKey of fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid?
The InChIKey is UXWPEAXKBZOXPJ-QXMOYCCXSA-N. The full InChI is InChI=1S/C8H12FO2P/c1-3-5-8(6-4-2)7-12(9,10)11/h3-6H,1,7H2,2H3,(H,10,11)/b6-4-,8-5+.
What are the key properties of fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid?
fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid has a molecular weight of 190.15 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phosphinic acid is sourced from PubChem (CID 142143106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).