C15H25O3P — CID 54211224
3,7,11-trimethyldodeca-2,4,6,10-tetraenylphosphonic acid (PubChem CID 54211224) has the molecular formula C15H25O3P and a molecular weight of 284.34 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-2,4,6,10-tetraenylphosphonic acid.
| Compound Name | 3,7,11-trimethyldodeca-2,4,6,10-tetraenylphosphonic acid |
|---|---|
| PubChem CID | 54211224 |
| Molecular Formula | C15H25O3P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 3,7,11-trimethyldodeca-2,4,6,10-tetraenylphosphonic acid |
| SMILES | CC(C)=CCCC(C)=CC=CC(C)=CCP(=O)(O)O |
| InChI | InChI=1S/C15H25O3P/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-19(16,17)18/h6-7,9-11H,5,8,12H2,1-4H3,(H2,16,17,18) |
| InChIKey | PWBRDHJUJKCOAK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|