C11H20FO2P — CID 143340153
[(2E)-2-ethyl-4,5-dimethylhexa-2,4-dienyl]-(fluoromethyl)phosphinic acid (PubChem CID 143340153) has the molecular formula C11H20FO2P and a molecular weight of 234.25 g/mol. Its IUPAC name is [(2E)-2-ethyl-4,5-dimethylhexa-2,4-dienyl]-(fluoromethyl)phosphinic acid.
| Compound Name | [(2E)-2-ethyl-4,5-dimethylhexa-2,4-dienyl]-(fluoromethyl)phosphinic acid |
|---|---|
| PubChem CID | 143340153 |
| Molecular Formula | C11H20FO2P |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | [(2E)-2-ethyl-4,5-dimethylhexa-2,4-dienyl]-(fluoromethyl)phosphinic acid |
| SMILES | CC/C(=C\C(C)=C(C)C)CP(=O)(O)CF |
| InChI | InChI=1S/C11H20FO2P/c1-5-11(6-10(4)9(2)3)7-15(13,14)8-12/h6H,5,7-8H2,1-4H3,(H,13,14)/b11-6+ |
| InChIKey | RHCGNPFBHLATBX-IZZDOVSWSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|