C10H19O3P — CID 87918701
[(3E)-4-ethyl-6-methylhepta-3,5-dien-3-yl]phosphonic acid (PubChem CID 87918701) has the molecular formula C10H19O3P and a molecular weight of 218.23 g/mol. Its IUPAC name is [(3E)-4-ethyl-6-methylhepta-3,5-dien-3-yl]phosphonic acid.
| Compound Name | [(3E)-4-ethyl-6-methylhepta-3,5-dien-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 87918701 |
| Molecular Formula | C10H19O3P |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | [(3E)-4-ethyl-6-methylhepta-3,5-dien-3-yl]phosphonic acid |
| SMILES | CC/C(C=C(C)C)=C(/CC)P(=O)(O)O |
| InChI | InChI=1S/C10H19O3P/c1-5-9(7-8(3)4)10(6-2)14(11,12)13/h7H,5-6H2,1-4H3,(H2,11,12,13)/b10-9+ |
| InChIKey | CNOXTXQJOVVBQT-MDZDMXLPSA-N |
| XLogP | 3.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|