2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid

C17H31O3P — CID 91611249

IUPAC2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid
SMILESCC(C)=CCCC(C)=CCCC(C)=CC(C)(C)P(=O)(O)O
InChIInChI=1S/C17H31O3P/c1-14(2)9-7-10-15(3)11-8-12-16(4)13-17(5,6)21(18,19)20/h9,11,13H,7-8,10,12H2,1-6H3,(H2,18,19,20)
InChIKeyOYQOXMHCFPRYPF-UHFFFAOYSA-N
MW314.41 g/mol
LogP5.36
Rot. Bonds8

About 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid

2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid (PubChem CID 91611249) has the molecular formula C17H31O3P and a molecular weight of 314.41 g/mol. Its IUPAC name is 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid.

Molecular Properties

Compound Name2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid
PubChem CID91611249
Molecular FormulaC17H31O3P
Molecular Weight314.41 g/mol
Exact Mass314.20
IUPAC Name2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid
SMILESCC(C)=CCCC(C)=CCCC(C)=CC(C)(C)P(=O)(O)O
InChIInChI=1S/C17H31O3P/c1-14(2)9-7-10-15(3)11-8-12-16(4)13-17(5,6)21(18,19)20/h9,11,13H,7-8,10,12H2,1-6H3,(H2,18,19,20)
InChIKeyOYQOXMHCFPRYPF-UHFFFAOYSA-N
XLogP5.36
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500314.41
LogP ≤ 55.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid?
The IUPAC name of 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid (CID 91611249) is 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid.
What is the SMILES notation for 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid?
The canonical SMILES for 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid is CC(C)=CCCC(C)=CCCC(C)=CC(C)(C)P(=O)(O)O.
What is the InChIKey of 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid?
The InChIKey is OYQOXMHCFPRYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31O3P/c1-14(2)9-7-10-15(3)11-8-12-16(4)13-17(5,6)21(18,19)20/h9,11,13H,7-8,10,12H2,1-6H3,(H2,18,19,20).
What are the key properties of 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid?
2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid has a molecular weight of 314.41 g/mol, XLogP of 5.36, 8 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid is sourced from PubChem (CID 91611249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).