C17H31O3P — CID 91611249
2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid (PubChem CID 91611249) has the molecular formula C17H31O3P and a molecular weight of 314.41 g/mol. Its IUPAC name is 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid.
| Compound Name | 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid |
|---|---|
| PubChem CID | 91611249 |
| Molecular Formula | C17H31O3P |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2,4,8,12-tetramethyltrideca-3,7,11-trien-2-ylphosphonic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(C)(C)P(=O)(O)O |
| InChI | InChI=1S/C17H31O3P/c1-14(2)9-7-10-15(3)11-8-12-16(4)13-17(5,6)21(18,19)20/h9,11,13H,7-8,10,12H2,1-6H3,(H2,18,19,20) |
| InChIKey | OYQOXMHCFPRYPF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|