4-ethylhepta-3,5-dien-3-ylphosphonic acid

C9H17O3P — CID 90935578

IUPAC4-ethylhepta-3,5-dien-3-ylphosphonic acid
SMILESCC=CC(CC)=C(CC)P(=O)(O)O
InChIInChI=1S/C9H17O3P/c1-4-7-8(5-2)9(6-3)13(10,11)12/h4,7H,5-6H2,1-3H3,(H2,10,11,12)
InChIKeyZCOKDHAIRKEIIB-UHFFFAOYSA-N
MW204.21 g/mol
LogP2.81
Rot. Bonds4

About 4-ethylhepta-3,5-dien-3-ylphosphonic acid

4-ethylhepta-3,5-dien-3-ylphosphonic acid (PubChem CID 90935578) has the molecular formula C9H17O3P and a molecular weight of 204.21 g/mol. Its IUPAC name is 4-ethylhepta-3,5-dien-3-ylphosphonic acid.

Molecular Properties

Compound Name4-ethylhepta-3,5-dien-3-ylphosphonic acid
PubChem CID90935578
Molecular FormulaC9H17O3P
Molecular Weight204.21 g/mol
Exact Mass204.09
IUPAC Name4-ethylhepta-3,5-dien-3-ylphosphonic acid
SMILESCC=CC(CC)=C(CC)P(=O)(O)O
InChIInChI=1S/C9H17O3P/c1-4-7-8(5-2)9(6-3)13(10,11)12/h4,7H,5-6H2,1-3H3,(H2,10,11,12)
InChIKeyZCOKDHAIRKEIIB-UHFFFAOYSA-N
XLogP2.81
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.21
LogP ≤ 52.81
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 4-ethylhepta-3,5-dien-3-ylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethylhepta-3,5-dien-3-ylphosphonic acid?
The IUPAC name of 4-ethylhepta-3,5-dien-3-ylphosphonic acid (CID 90935578) is 4-ethylhepta-3,5-dien-3-ylphosphonic acid.
What is the SMILES notation for 4-ethylhepta-3,5-dien-3-ylphosphonic acid?
The canonical SMILES for 4-ethylhepta-3,5-dien-3-ylphosphonic acid is CC=CC(CC)=C(CC)P(=O)(O)O.
What is the InChIKey of 4-ethylhepta-3,5-dien-3-ylphosphonic acid?
The InChIKey is ZCOKDHAIRKEIIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17O3P/c1-4-7-8(5-2)9(6-3)13(10,11)12/h4,7H,5-6H2,1-3H3,(H2,10,11,12).
What are the key properties of 4-ethylhepta-3,5-dien-3-ylphosphonic acid?
4-ethylhepta-3,5-dien-3-ylphosphonic acid has a molecular weight of 204.21 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylhepta-3,5-dien-3-ylphosphonic acid is sourced from PubChem (CID 90935578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).