C25H30N8O2S — CID 142145435
4-[4-[[4-[4-[amino(1-sulfanylpropyl)amino]phenyl]pyrimidin-2-yl]amino]benzoyl]piperazine-1-carboxamide (PubChem CID 142145435) has the molecular formula C25H30N8O2S and a molecular weight of 506.64 g/mol. Its IUPAC name is 4-[4-[[4-[4-[amino(1-sulfanylpropyl)amino]phenyl]pyrimidin-2-yl]amino]benzoyl]piperazine-1-carboxamide.
| Compound Name | 4-[4-[[4-[4-[amino(1-sulfanylpropyl)amino]phenyl]pyrimidin-2-yl]amino]benzoyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 142145435 |
| Molecular Formula | C25H30N8O2S |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 4-[4-[[4-[4-[amino(1-sulfanylpropyl)amino]phenyl]pyrimidin-2-yl]amino]benzoyl]piperazine-1-carboxamide |
| SMILES | CCC(S)N(N)c1ccc(-c2ccnc(Nc3ccc(C(=O)N4CCN(C(N)=O)CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C25H30N8O2S/c1-2-22(36)33(27)20-9-5-17(6-10-20)21-11-12-28-25(30-21)29-19-7-3-18(4-8-19)23(34)31-13-15-32(16-14-31)24(26)35/h3-12,22,36H,2,13-16,27H2,1H3,(H2,26,35)(H,28,29,30) |
| InChIKey | AOADBJLSYXLPTJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 133.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|